About 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine
1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine (PubChem CID 67054638) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine.
Molecular Properties
| Compound Name | 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine |
| PubChem CID | 67054638 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine |
| SMILES | C[C@@H]1CCCN1C[C@H]1C[C@@H]1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N2/c1-16-6-5-13-22(16)15-18-14-20(18)17-7-9-19(10-8-17)21-11-3-2-4-12-21/h7-10,16,18,20H,2-6,11-15H2,1H3/t16-,18-,20-/m1/s1 |
| InChIKey | ZZVHASJLOPSOJV-YVWKXTFCSA-N |
| XLogP | 4.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine?
The IUPAC name of 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine (CID 67054638) is 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine.
What is the SMILES notation for 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine?
The canonical SMILES for 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine is C[C@@H]1CCCN1C[C@H]1C[C@@H]1c1ccc(N2CCCCC2)cc1.
What is the InChIKey of 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine?
The InChIKey is ZZVHASJLOPSOJV-YVWKXTFCSA-N. The full InChI is InChI=1S/C20H30N2/c1-16-6-5-13-22(16)15-18-14-20(18)17-7-9-19(10-8-17)21-11-3-2-4-12-21/h7-10,16,18,20H,2-6,11-15H2,1H3/t16-,18-,20-/m1/s1.
What are the key properties of 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine?
1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine has a molecular weight of 298.47 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1S,2S)-2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]cyclopropyl]phenyl]piperidine is sourced from PubChem (CID 67054638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).