C26H43B2N3O4 — CID 67054649
2-(2-ethylhexyl)-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole (PubChem CID 67054649) has the molecular formula C26H43B2N3O4 and a molecular weight of 483.27 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole.
| Compound Name | 2-(2-ethylhexyl)-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole |
|---|---|
| PubChem CID | 67054649 |
| Molecular Formula | C26H43B2N3O4 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.34 |
| IUPAC Name | 2-(2-ethylhexyl)-4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole |
| SMILES | CCCCC(CC)Cn1nc2c(B3OC(C)(C)C(C)(C)O3)ccc(B3OC(C)(C)C(C)(C)O3)c2n1 |
| InChI | InChI=1S/C26H43B2N3O4/c1-11-13-14-18(12-2)17-31-29-21-19(27-32-23(3,4)24(5,6)33-27)15-16-20(22(21)30-31)28-34-25(7,8)26(9,10)35-28/h15-16,18H,11-14,17H2,1-10H3 |
| InChIKey | UWNBCFXRZHYSRF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|