C15H17F3O4S — CID 67054681
1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylic acid (PubChem CID 67054681) has the molecular formula C15H17F3O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylic acid.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67054681 |
| Molecular Formula | C15H17F3O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H17F3O4S/c1-14(13(19)20)7-5-11(6-8-14)23(21,22)12-4-2-3-10(9-12)15(16,17)18/h2-4,9,11H,5-8H2,1H3,(H,19,20) |
| InChIKey | TTWGIIPOYILGQN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |