About 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane
2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane (PubChem CID 67054904) has the molecular formula C16H19F3O4S
and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane |
| PubChem CID | 67054904 |
| Molecular Formula | C16H19F3O4S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane |
| SMILES | CC(C)C1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC2(C1)OCCO2 |
| InChI | InChI=1S/C16H19F3O4S/c1-11(2)14(9-15(10-14)22-6-7-23-15)24(20,21)13-5-3-4-12(8-13)16(17,18)19/h3-5,8,11H,6-7,9-10H2,1-2H3 |
| InChIKey | RKSYDZMAPKQWCG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane?
The IUPAC name of 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane (CID 67054904) is 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane.
What is the SMILES notation for 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane?
The canonical SMILES for 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane is CC(C)C1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC2(C1)OCCO2.
What is the InChIKey of 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane?
The InChIKey is RKSYDZMAPKQWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3O4S/c1-11(2)14(9-15(10-14)22-6-7-23-15)24(20,21)13-5-3-4-12(8-13)16(17,18)19/h3-5,8,11H,6-7,9-10H2,1-2H3.
What are the key properties of 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane?
2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane has a molecular weight of 364.39 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]sulfonyl-5,8-dioxaspiro[3.4]octane is sourced from PubChem (CID 67054904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).