About 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol
3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol (PubChem CID 67054907) has the molecular formula C14H17F3O3S
and a molecular weight of 322.35 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol |
| PubChem CID | 67054907 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol |
| SMILES | CC(CC(F)(F)F)(C1CC(O)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17F3O3S/c1-13(9-14(15,16)17,10-7-11(18)8-10)21(19,20)12-5-3-2-4-6-12/h2-6,10-11,18H,7-9H2,1H3 |
| InChIKey | QGFKFRPRVKFXIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol?
The IUPAC name of 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol (CID 67054907) is 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol.
What is the SMILES notation for 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol?
The canonical SMILES for 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol is CC(CC(F)(F)F)(C1CC(O)C1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol?
The InChIKey is QGFKFRPRVKFXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3O3S/c1-13(9-14(15,16)17,10-7-11(18)8-10)21(19,20)12-5-3-2-4-6-12/h2-6,10-11,18H,7-9H2,1H3.
What are the key properties of 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol?
3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol has a molecular weight of 322.35 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(benzenesulfonyl)-4,4,4-trifluorobutan-2-yl]cyclobutan-1-ol is sourced from PubChem (CID 67054907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).