C24H35N7OSi — CID 67054934
4-piperidin-4-yl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile (PubChem CID 67054934) has the molecular formula C24H35N7OSi and a molecular weight of 465.68 g/mol. Its IUPAC name is 4-piperidin-4-yl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 4-piperidin-4-yl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 67054934 |
| Molecular Formula | C24H35N7OSi |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 4-piperidin-4-yl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)CC4CCNCC4)c3)ncnc21 |
| InChI | InChI=1S/C24H35N7OSi/c1-33(2,3)13-12-32-18-30-11-7-22-23(27-17-28-24(22)30)20-15-29-31(16-20)21(4-8-25)14-19-5-9-26-10-6-19/h7,11,15-17,19,21,26H,4-6,9-10,12-14,18H2,1-3H3 |
| InChIKey | BBQQBRQCTNHYOC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|