C29H42F2N8O3Si — CID 67054966
tert-butyl 4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carboxylate (PubChem CID 67054966) has the molecular formula C29H42F2N8O3Si and a molecular weight of 616.79 g/mol. Its IUPAC name is tert-butyl 4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67054966 |
| Molecular Formula | C29H42F2N8O3Si |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | tert-butyl 4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(CC#N)n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)cn2)C(C(F)F)C1 |
| InChI | InChI=1S/C29H42F2N8O3Si/c1-29(2,3)42-28(40)37-12-11-36(24(18-37)26(30)31)17-22(7-9-32)39-16-21(15-35-39)25-23-8-10-38(27(23)34-19-33-25)20-41-13-14-43(4,5)6/h8,10,15-16,19,22,24,26H,7,11-14,17-18,20H2,1-6H3 |
| InChIKey | FJDNQWSIGHTANQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 114.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|