C25H27N5O2 — CID 67055023
(2S)-N-[(2R)-2-cyano-2-[4-[3-(2-cyanoethylcarbamoyl)phenyl]phenyl]ethyl]piperidine-2-carboxamide (PubChem CID 67055023) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-cyano-2-[4-[3-(2-cyanoethylcarbamoyl)phenyl]phenyl]ethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-2-cyano-2-[4-[3-(2-cyanoethylcarbamoyl)phenyl]phenyl]ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 67055023 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (2S)-N-[(2R)-2-cyano-2-[4-[3-(2-cyanoethylcarbamoyl)phenyl]phenyl]ethyl]piperidine-2-carboxamide |
| SMILES | N#CCCNC(=O)c1cccc(-c2ccc([C@@H](C#N)CNC(=O)[C@@H]3CCCCN3)cc2)c1 |
| InChI | InChI=1S/C25H27N5O2/c26-12-4-14-29-24(31)21-6-3-5-20(15-21)18-8-10-19(11-9-18)22(16-27)17-30-25(32)23-7-1-2-13-28-23/h3,5-6,8-11,15,22-23,28H,1-2,4,7,13-14,17H2,(H,29,31)(H,30,32)/t22-,23-/m0/s1 |
| InChIKey | IJHMUQYFJWEWHP-GOTSBHOMSA-N |
| XLogP | 2.86 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|