C32H36F3N9O2Si — CID 67055048
4-[4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carbonyl]-3-fluorobenzonitrile (PubChem CID 67055048) has the molecular formula C32H36F3N9O2Si and a molecular weight of 663.78 g/mol. Its IUPAC name is 4-[4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carbonyl]-3-fluorobenzonitrile.
| Compound Name | 4-[4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carbonyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 67055048 |
| Molecular Formula | C32H36F3N9O2Si |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 4-[4-[3-cyano-2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propyl]-3-(difluoromethyl)piperazine-1-carbonyl]-3-fluorobenzonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)CN4CCN(C(=O)c5ccc(C#N)cc5F)CC4C(F)F)c3)ncnc21 |
| InChI | InChI=1S/C32H36F3N9O2Si/c1-47(2,3)13-12-46-21-43-9-7-26-29(38-20-39-31(26)43)23-16-40-44(17-23)24(6-8-36)18-41-10-11-42(19-28(41)30(34)35)32(45)25-5-4-22(15-37)14-27(25)33/h4-5,7,9,14,16-17,20,24,28,30H,6,10-13,18-19,21H2,1-3H3 |
| InChIKey | DMVLRCNOBHUSAG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 128.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|