About 1-ethenyl-2,7-difluoro-9H-carbazole
1-ethenyl-2,7-difluoro-9H-carbazole (PubChem CID 67055233) has the molecular formula C14H9F2N
and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-ethenyl-2,7-difluoro-9H-carbazole.
Molecular Properties
| Compound Name | 1-ethenyl-2,7-difluoro-9H-carbazole |
| PubChem CID | 67055233 |
| Molecular Formula | C14H9F2N |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-ethenyl-2,7-difluoro-9H-carbazole |
| SMILES | C=Cc1c(F)ccc2c1[nH]c1cc(F)ccc12 |
| InChI | InChI=1S/C14H9F2N/c1-2-9-12(16)6-5-11-10-4-3-8(15)7-13(10)17-14(9)11/h2-7,17H,1H2 |
| InChIKey | TWCGGHFCOCIAAG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-2,7-difluoro-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,7-difluoro-9H-carbazole?
The IUPAC name of 1-ethenyl-2,7-difluoro-9H-carbazole (CID 67055233) is 1-ethenyl-2,7-difluoro-9H-carbazole.
What is the SMILES notation for 1-ethenyl-2,7-difluoro-9H-carbazole?
The canonical SMILES for 1-ethenyl-2,7-difluoro-9H-carbazole is C=Cc1c(F)ccc2c1[nH]c1cc(F)ccc12.
What is the InChIKey of 1-ethenyl-2,7-difluoro-9H-carbazole?
The InChIKey is TWCGGHFCOCIAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2N/c1-2-9-12(16)6-5-11-10-4-3-8(15)7-13(10)17-14(9)11/h2-7,17H,1H2.
What are the key properties of 1-ethenyl-2,7-difluoro-9H-carbazole?
1-ethenyl-2,7-difluoro-9H-carbazole has a molecular weight of 229.23 g/mol, XLogP of 4.24, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,7-difluoro-9H-carbazole is sourced from PubChem (CID 67055233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).