C18H22N2S2 — CID 67055326
(E)-2,3-bis(2,4,5-trimethyl-3H-thiophen-2-yl)but-2-enedinitrile (PubChem CID 67055326) has the molecular formula C18H22N2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is (E)-2,3-bis(2,4,5-trimethyl-3H-thiophen-2-yl)but-2-enedinitrile.
| Compound Name | (E)-2,3-bis(2,4,5-trimethyl-3H-thiophen-2-yl)but-2-enedinitrile |
|---|---|
| PubChem CID | 67055326 |
| Molecular Formula | C18H22N2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (E)-2,3-bis(2,4,5-trimethyl-3H-thiophen-2-yl)but-2-enedinitrile |
| SMILES | CC1=C(C)SC(C)(/C(C#N)=C(\C#N)C2(C)CC(C)=C(C)S2)C1 |
| InChI | InChI=1S/C18H22N2S2/c1-11-7-17(5,21-13(11)3)15(9-19)16(10-20)18(6)8-12(2)14(4)22-18/h7-8H2,1-6H3/b16-15+ |
| InChIKey | PBEVATXJHJOJIB-FOCLMDBBSA-N |
| XLogP | 5.71 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|