C21H26N2O2 — CID 67055545
4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diamine (PubChem CID 67055545) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diamine.
| Compound Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diamine |
|---|---|
| PubChem CID | 67055545 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7,7'-diamine |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(N)cc3O2)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C21H26N2O2/c1-19(2)11-21(24-17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)25-21/h5-10H,11-12,22-23H2,1-4H3 |
| InChIKey | ZMVGDQNBHMYYOA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|