About 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine
2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 67055603) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 67055603 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | COc1ccc(-c2n[nH]c(C3CCNCC3)n2)cn1 |
| InChI | InChI=1S/C13H17N5O/c1-19-11-3-2-10(8-15-11)13-16-12(17-18-13)9-4-6-14-7-5-9/h2-3,8-9,14H,4-7H2,1H3,(H,16,17,18) |
| InChIKey | VNQNHUXDPONBQY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (CID 67055603) is 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine is COc1ccc(-c2n[nH]c(C3CCNCC3)n2)cn1.
What is the InChIKey of 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine?
The InChIKey is VNQNHUXDPONBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-19-11-3-2-10(8-15-11)13-16-12(17-18-13)9-4-6-14-7-5-9/h2-3,8-9,14H,4-7H2,1H3,(H,16,17,18).
What are the key properties of 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine?
2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine has a molecular weight of 259.31 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 67055603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).