About 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline
1-(triazol-1-yl)-3,4-dihydro-2H-quinoline (PubChem CID 67055696) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline |
| PubChem CID | 67055696 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc2c(c1)CCCN2n1ccnn1 |
| InChI | InChI=1S/C11H12N4/c1-2-6-11-10(4-1)5-3-8-14(11)15-9-7-12-13-15/h1-2,4,6-7,9H,3,5,8H2 |
| InChIKey | ZIJGFTIHGXUMJD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline (CID 67055696) is 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline is c1ccc2c(c1)CCCN2n1ccnn1.
What is the InChIKey of 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline?
The InChIKey is ZIJGFTIHGXUMJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-2-6-11-10(4-1)5-3-8-14(11)15-9-7-12-13-15/h1-2,4,6-7,9H,3,5,8H2.
What are the key properties of 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline?
1-(triazol-1-yl)-3,4-dihydro-2H-quinoline has a molecular weight of 200.25 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(triazol-1-yl)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 67055696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).