C12H16BN3O3 — CID 67055927
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 67055927) has the molecular formula C12H16BN3O3 and a molecular weight of 261.09 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67055927 |
| Molecular Formula | C12H16BN3O3 |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | CC1(C)OB(c2cnc3[nH]c(=O)[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C12H16BN3O3/c1-11(2)12(3,4)19-13(18-11)7-5-8-9(14-6-7)16-10(17)15-8/h5-6H,1-4H3,(H2,14,15,16,17) |
| InChIKey | DAVIOYDLBLBRBT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|