C16H20ClN5O6 — CID 67056509
[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]carbamic acid (PubChem CID 67056509) has the molecular formula C16H20ClN5O6 and a molecular weight of 413.82 g/mol. Its IUPAC name is [(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]carbamic acid.
| Compound Name | [(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67056509 |
| Molecular Formula | C16H20ClN5O6 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]carbamic acid |
| SMILES | COCC(=O)N1CC[C@H](NC(=O)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C16H20ClN5O6/c1-28-8-13(23)22-5-4-10(11(7-22)20-16(26)27)19-14(24)15(25)21-12-3-2-9(17)6-18-12/h2-3,6,10-11,20H,4-5,7-8H2,1H3,(H,19,24)(H,26,27)(H,18,21,25)/t10-,11+/m0/s1 |
| InChIKey | HPPXJFBTYHSKIH-WDEREUQCSA-N |
| XLogP | -0.33 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|