C24H29ClN6O4S2 — CID 67056873
N-[(3R,4S)-4-[(5-chloro-1H-indole-2-carbonyl)amino]-1-methylsulfonylpyrrolidin-3-yl]-5-propan-2-yl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 67056873) has the molecular formula C24H29ClN6O4S2 and a molecular weight of 565.12 g/mol. Its IUPAC name is N-[(3R,4S)-4-[(5-chloro-1H-indole-2-carbonyl)amino]-1-methylsulfonylpyrrolidin-3-yl]-5-propan-2-yl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(3R,4S)-4-[(5-chloro-1H-indole-2-carbonyl)amino]-1-methylsulfonylpyrrolidin-3-yl]-5-propan-2-yl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67056873 |
| Molecular Formula | C24H29ClN6O4S2 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | N-[(3R,4S)-4-[(5-chloro-1H-indole-2-carbonyl)amino]-1-methylsulfonylpyrrolidin-3-yl]-5-propan-2-yl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CC(C)N1CCc2nc(C(=O)N[C@@H]3CN(S(C)(=O)=O)C[C@@H]3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C24H29ClN6O4S2/c1-13(2)30-7-6-17-21(12-30)36-24(29-17)23(33)28-20-11-31(37(3,34)35)10-19(20)27-22(32)18-9-14-8-15(25)4-5-16(14)26-18/h4-5,8-9,13,19-20,26H,6-7,10-12H2,1-3H3,(H,27,32)(H,28,33)/t19-,20+/m0/s1 |
| InChIKey | YITWMBVMHVONQN-VQTJNVASSA-N |
| XLogP | 2.22 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |