About 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol
4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol (PubChem CID 67057408) has the molecular formula C26H18F4O2S
and a molecular weight of 470.49 g/mol. Its IUPAC name is 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol |
| PubChem CID | 67057408 |
| Molecular Formula | C26H18F4O2S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)(c2ccccc2Sc2ccc(F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H18F4O2S/c27-19-9-15-22(16-10-19)33-24-4-2-1-3-23(24)25(26(28,29)30,17-5-11-20(31)12-6-17)18-7-13-21(32)14-8-18/h1-16,31-32H |
| InChIKey | QUMRENMYOVPEPK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol?
The IUPAC name of 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol (CID 67057408) is 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol.
What is the SMILES notation for 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol?
The canonical SMILES for 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol is Oc1ccc(C(c2ccc(O)cc2)(c2ccccc2Sc2ccc(F)cc2)C(F)(F)F)cc1.
What is the InChIKey of 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol?
The InChIKey is QUMRENMYOVPEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18F4O2S/c27-19-9-15-22(16-10-19)33-24-4-2-1-3-23(24)25(26(28,29)30,17-5-11-20(31)12-6-17)18-7-13-21(32)14-8-18/h1-16,31-32H.
What are the key properties of 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol?
4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol has a molecular weight of 470.49 g/mol, XLogP of 7.28, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2,2-trifluoro-1-[2-(4-fluorophenyl)sulfanylphenyl]-1-(4-hydroxyphenyl)ethyl]phenol is sourced from PubChem (CID 67057408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).