About 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine
5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine (PubChem CID 67057573) has the molecular formula C8H7BrN4O
and a molecular weight of 255.07 g/mol. Its IUPAC name is 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine |
| PubChem CID | 67057573 |
| Molecular Formula | C8H7BrN4O |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine |
| SMILES | Cc1nnc(-c2cc(Br)cnc2N)o1 |
| InChI | InChI=1S/C8H7BrN4O/c1-4-12-13-8(14-4)6-2-5(9)3-11-7(6)10/h2-3H,1H3,(H2,10,11) |
| InChIKey | HWYZSTKJNKXLIB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine?
The IUPAC name of 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine (CID 67057573) is 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine.
What is the SMILES notation for 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine?
The canonical SMILES for 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine is Cc1nnc(-c2cc(Br)cnc2N)o1.
What is the InChIKey of 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine?
The InChIKey is HWYZSTKJNKXLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4O/c1-4-12-13-8(14-4)6-2-5(9)3-11-7(6)10/h2-3H,1H3,(H2,10,11).
What are the key properties of 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine?
5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine has a molecular weight of 255.07 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-2-amine is sourced from PubChem (CID 67057573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).