About 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione
2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione (PubChem CID 67057841) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione |
| PubChem CID | 67057841 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione |
| SMILES | CC1=C(Cc2ccc(N)cc2)C(=O)C2C=CC=CC2C1=O |
| InChI | InChI=1S/C18H17NO2/c1-11-16(10-12-6-8-13(19)9-7-12)18(21)15-5-3-2-4-14(15)17(11)20/h2-9,14-15H,10,19H2,1H3 |
| InChIKey | RVMBCURJHLFZEV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione?
The IUPAC name of 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione (CID 67057841) is 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione.
What is the SMILES notation for 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione?
The canonical SMILES for 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione is CC1=C(Cc2ccc(N)cc2)C(=O)C2C=CC=CC2C1=O.
What is the InChIKey of 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione?
The InChIKey is RVMBCURJHLFZEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-11-16(10-12-6-8-13(19)9-7-12)18(21)15-5-3-2-4-14(15)17(11)20/h2-9,14-15H,10,19H2,1H3.
What are the key properties of 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione?
2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione has a molecular weight of 279.34 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-aminophenyl)methyl]-3-methyl-4a,8a-dihydronaphthalene-1,4-dione is sourced from PubChem (CID 67057841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).