About pyrrolo[2,3-c]pyridin-7-one
pyrrolo[2,3-c]pyridin-7-one (PubChem CID 67057869) has the molecular formula C7H4N2O
and a molecular weight of 132.12 g/mol. Its IUPAC name is pyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | pyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 67057869 |
| Molecular Formula | C7H4N2O |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | pyrrolo[2,3-c]pyridin-7-one |
| SMILES | O=C1N=CC=C2C=CN=C12 |
| InChI | InChI=1S/C7H4N2O/c10-7-6-5(1-3-8-6)2-4-9-7/h1-4H |
| InChIKey | XFAWJIWICBTYDC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of pyrrolo[2,3-c]pyridin-7-one (CID 67057869) is pyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for pyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for pyrrolo[2,3-c]pyridin-7-one is O=C1N=CC=C2C=CN=C12.
What is the InChIKey of pyrrolo[2,3-c]pyridin-7-one?
The InChIKey is XFAWJIWICBTYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O/c10-7-6-5(1-3-8-6)2-4-9-7/h1-4H.
What are the key properties of pyrrolo[2,3-c]pyridin-7-one?
pyrrolo[2,3-c]pyridin-7-one has a molecular weight of 132.12 g/mol, XLogP of 0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 67057869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).