About 2-propyl-1H-imidazole;trifluoromethanesulfonamide
2-propyl-1H-imidazole;trifluoromethanesulfonamide (PubChem CID 67058160) has the molecular formula C7H12F3N3O2S
and a molecular weight of 259.25 g/mol. Its IUPAC name is 2-propyl-1H-imidazole;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | 2-propyl-1H-imidazole;trifluoromethanesulfonamide |
| PubChem CID | 67058160 |
| Molecular Formula | C7H12F3N3O2S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-propyl-1H-imidazole;trifluoromethanesulfonamide |
| SMILES | CCCc1ncc[nH]1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.CH2F3NO2S/c1-2-3-6-7-4-5-8-6;2-1(3,4)8(5,6)7/h4-5H,2-3H2,1H3,(H,7,8);(H2,5,6,7) |
| InChIKey | XLJRRCBDZVFZKK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-1H-imidazole;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1H-imidazole;trifluoromethanesulfonamide?
The IUPAC name of 2-propyl-1H-imidazole;trifluoromethanesulfonamide (CID 67058160) is 2-propyl-1H-imidazole;trifluoromethanesulfonamide.
What is the SMILES notation for 2-propyl-1H-imidazole;trifluoromethanesulfonamide?
The canonical SMILES for 2-propyl-1H-imidazole;trifluoromethanesulfonamide is CCCc1ncc[nH]1.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of 2-propyl-1H-imidazole;trifluoromethanesulfonamide?
The InChIKey is XLJRRCBDZVFZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.CH2F3NO2S/c1-2-3-6-7-4-5-8-6;2-1(3,4)8(5,6)7/h4-5H,2-3H2,1H3,(H,7,8);(H2,5,6,7).
What are the key properties of 2-propyl-1H-imidazole;trifluoromethanesulfonamide?
2-propyl-1H-imidazole;trifluoromethanesulfonamide has a molecular weight of 259.25 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1H-imidazole;trifluoromethanesulfonamide is sourced from PubChem (CID 67058160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).