C19H20Cl2O4 — CID 67058217
ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate (PubChem CID 67058217) has the molecular formula C19H20Cl2O4 and a molecular weight of 383.27 g/mol. Its IUPAC name is ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate.
| Compound Name | ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate |
|---|---|
| PubChem CID | 67058217 |
| Molecular Formula | C19H20Cl2O4 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate |
| SMILES | CCOC(=O)CC(OCC)c1ccc(Oc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20Cl2O4/c1-3-23-18(12-19(22)24-4-2)13-5-7-16(8-6-13)25-17-10-14(20)9-15(21)11-17/h5-11,18H,3-4,12H2,1-2H3 |
| InChIKey | DGSOGYOVFVRYQT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |