About ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate
ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate (PubChem CID 67058217) has the molecular formula C19H20Cl2O4
and a molecular weight of 383.27 g/mol. Its IUPAC name is ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate |
| PubChem CID | 67058217 |
| Molecular Formula | C19H20Cl2O4 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate |
| SMILES | CCOC(=O)CC(OCC)c1ccc(Oc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20Cl2O4/c1-3-23-18(12-19(22)24-4-2)13-5-7-16(8-6-13)25-17-10-14(20)9-15(21)11-17/h5-11,18H,3-4,12H2,1-2H3 |
| InChIKey | DGSOGYOVFVRYQT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate?
The IUPAC name of ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate (CID 67058217) is ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate.
What is the SMILES notation for ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate?
The canonical SMILES for ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate is CCOC(=O)CC(OCC)c1ccc(Oc2cc(Cl)cc(Cl)c2)cc1.
What is the InChIKey of ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate?
The InChIKey is DGSOGYOVFVRYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2O4/c1-3-23-18(12-19(22)24-4-2)13-5-7-16(8-6-13)25-17-10-14(20)9-15(21)11-17/h5-11,18H,3-4,12H2,1-2H3.
What are the key properties of ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate?
ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate has a molecular weight of 383.27 g/mol, XLogP of 5.82, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(3,5-dichlorophenoxy)phenyl]-3-ethoxypropanoate is sourced from PubChem (CID 67058217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).