C19H23F3N2O3 — CID 67058581
N-butyl-2-[3-[4-propoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]acetamide (PubChem CID 67058581) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-butyl-2-[3-[4-propoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]acetamide.
| Compound Name | N-butyl-2-[3-[4-propoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 67058581 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-butyl-2-[3-[4-propoxy-2-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1cc(-c2ccc(OCCC)cc2C(F)(F)F)no1 |
| InChI | InChI=1S/C19H23F3N2O3/c1-3-5-8-23-18(25)12-14-11-17(24-27-14)15-7-6-13(26-9-4-2)10-16(15)19(20,21)22/h6-7,10-11H,3-5,8-9,12H2,1-2H3,(H,23,25) |
| InChIKey | MMVIJLCCUHJLFS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|