C22H16Cl2O2 — CID 67059869
3-[3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-5-yl]benzoic acid (PubChem CID 67059869) has the molecular formula C22H16Cl2O2 and a molecular weight of 383.27 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-5-yl]benzoic acid.
| Compound Name | 3-[3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-5-yl]benzoic acid |
|---|---|
| PubChem CID | 67059869 |
| Molecular Formula | C22H16Cl2O2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[3-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-5-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc3c(c2)C(c2ccc(Cl)cc2Cl)CC3)c1 |
| InChI | InChI=1S/C22H16Cl2O2/c23-17-7-9-19(21(24)12-17)18-8-6-13-4-5-15(11-20(13)18)14-2-1-3-16(10-14)22(25)26/h1-5,7,9-12,18H,6,8H2,(H,25,26) |
| InChIKey | IGCYLVHICUYVCH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |