About 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one
5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one (PubChem CID 67059910) has the molecular formula C14H7BrCl2O2
and a molecular weight of 358.02 g/mol. Its IUPAC name is 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one |
| PubChem CID | 67059910 |
| Molecular Formula | C14H7BrCl2O2 |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one |
| SMILES | O=C1Oc2ccc(Br)cc2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H7BrCl2O2/c15-7-1-4-12-10(5-7)13(14(18)19-12)9-3-2-8(16)6-11(9)17/h1-6,13H |
| InChIKey | MVTBNCAZOQUJGJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one?
The IUPAC name of 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one (CID 67059910) is 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one.
What is the SMILES notation for 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one?
The canonical SMILES for 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one is O=C1Oc2ccc(Br)cc2C1c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one?
The InChIKey is MVTBNCAZOQUJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrCl2O2/c15-7-1-4-12-10(5-7)13(14(18)19-12)9-3-2-8(16)6-11(9)17/h1-6,13H.
What are the key properties of 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one?
5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one has a molecular weight of 358.02 g/mol, XLogP of 4.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2,4-dichlorophenyl)-3H-1-benzofuran-2-one is sourced from PubChem (CID 67059910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).