About 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile
3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile (PubChem CID 67060962) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile |
| PubChem CID | 67060962 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2NC(=O)NC(c3ccccc3)=C2c2ccccc2)c1 |
| InChI | InChI=1S/C23H17N3O/c24-15-16-8-7-13-19(14-16)22-20(17-9-3-1-4-10-17)21(25-23(27)26-22)18-11-5-2-6-12-18/h1-14,22H,(H2,25,26,27) |
| InChIKey | BMNJSHHPZXPPMH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The IUPAC name of 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile (CID 67060962) is 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile.
What is the SMILES notation for 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The canonical SMILES for 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile is N#Cc1cccc(C2NC(=O)NC(c3ccccc3)=C2c2ccccc2)c1.
What is the InChIKey of 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The InChIKey is BMNJSHHPZXPPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c24-15-16-8-7-13-19(14-16)22-20(17-9-3-1-4-10-17)21(25-23(27)26-22)18-11-5-2-6-12-18/h1-14,22H,(H2,25,26,27).
What are the key properties of 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile has a molecular weight of 351.41 g/mol, XLogP of 4.48, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile is sourced from PubChem (CID 67060962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).