C24H19FN2O4 — CID 67061120
methyl 3-fluoro-2-hydroxy-5-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoate (PubChem CID 67061120) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is methyl 3-fluoro-2-hydroxy-5-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoate.
| Compound Name | methyl 3-fluoro-2-hydroxy-5-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoate |
|---|---|
| PubChem CID | 67061120 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | methyl 3-fluoro-2-hydroxy-5-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoate |
| SMILES | COC(=O)c1cc(C2NC(=O)NC(c3ccccc3)=C2c2ccccc2)cc(F)c1O |
| InChI | InChI=1S/C24H19FN2O4/c1-31-23(29)17-12-16(13-18(25)22(17)28)21-19(14-8-4-2-5-9-14)20(26-24(30)27-21)15-10-6-3-7-11-15/h2-13,21,28H,1H3,(H2,26,27,30) |
| InChIKey | XMYZAHQXLWJDID-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|