C9H10Na2O4 — CID 67061189
disodium;(1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 67061189) has the molecular formula C9H10Na2O4 and a molecular weight of 228.15 g/mol. Its IUPAC name is disodium;(1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | disodium;(1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 67061189 |
| Molecular Formula | C9H10Na2O4 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | disodium;(1S,2S,3R,4R)-bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C([O-])[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H12O4.2Na/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13;;/h4-7H,1-3H2,(H,10,11)(H,12,13);;/q;2*+1/p-2/t4-,5+,6-,7+;; |
| InChIKey | FXDGCBFGSXNGQD-FAESFXMKSA-L |
| XLogP | -7.84 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | -7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |