C34H41NO4S — CID 67062393
1-(4-methoxyphenyl)sulfonyl-3-[(E)-12-phenylmethoxydodec-1-enyl]indole (PubChem CID 67062393) has the molecular formula C34H41NO4S and a molecular weight of 559.77 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-3-[(E)-12-phenylmethoxydodec-1-enyl]indole.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-3-[(E)-12-phenylmethoxydodec-1-enyl]indole |
|---|---|
| PubChem CID | 67062393 |
| Molecular Formula | C34H41NO4S |
| Molecular Weight | 559.77 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-3-[(E)-12-phenylmethoxydodec-1-enyl]indole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(/C=C/CCCCCCCCCCOCc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H41NO4S/c1-38-31-22-24-32(25-23-31)40(36,37)35-27-30(33-20-14-15-21-34(33)35)19-13-8-6-4-2-3-5-7-9-16-26-39-28-29-17-11-10-12-18-29/h10-15,17-25,27H,2-9,16,26,28H2,1H3/b19-13+ |
| InChIKey | DLYSHFPQDHTVHS-CPNJWEJPSA-N |
| XLogP | 8.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.77 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|