About 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol
9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol (PubChem CID 67062810) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol.
Molecular Properties
| Compound Name | 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol |
| PubChem CID | 67062810 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol |
| SMILES | Cn1c2c(c3cc(O)ccc31)CCN=C2 |
| InChI | InChI=1S/C12H12N2O/c1-14-11-3-2-8(15)6-10(11)9-4-5-13-7-12(9)14/h2-3,6-7,15H,4-5H2,1H3 |
| InChIKey | QJVUZFWNZGCICJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol?
The IUPAC name of 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol (CID 67062810) is 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol.
What is the SMILES notation for 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol?
The canonical SMILES for 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol is Cn1c2c(c3cc(O)ccc31)CCN=C2.
What is the InChIKey of 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol?
The InChIKey is QJVUZFWNZGCICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-14-11-3-2-8(15)6-10(11)9-4-5-13-7-12(9)14/h2-3,6-7,15H,4-5H2,1H3.
What are the key properties of 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol?
9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol has a molecular weight of 200.24 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-3,4-dihydropyrido[3,4-b]indol-6-ol is sourced from PubChem (CID 67062810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).