C13H17ClN6S — CID 67064299
5-[3-[1-(thiophen-3-ylmethyl)triazol-4-yl]propyl]-1H-imidazol-2-amine;hydrochloride (PubChem CID 67064299) has the molecular formula C13H17ClN6S and a molecular weight of 324.84 g/mol. Its IUPAC name is 5-[3-[1-(thiophen-3-ylmethyl)triazol-4-yl]propyl]-1H-imidazol-2-amine;hydrochloride.
| Compound Name | 5-[3-[1-(thiophen-3-ylmethyl)triazol-4-yl]propyl]-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67064299 |
| Molecular Formula | C13H17ClN6S |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-[3-[1-(thiophen-3-ylmethyl)triazol-4-yl]propyl]-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncc(CCCc2cn(Cc3ccsc3)nn2)[nH]1 |
| InChI | InChI=1S/C13H16N6S.ClH/c14-13-15-6-11(16-13)2-1-3-12-8-19(18-17-12)7-10-4-5-20-9-10;/h4-6,8-9H,1-3,7H2,(H3,14,15,16);1H |
| InChIKey | KZBXIYILKOJSBW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |