C13H24N2O5 — CID 67065370
tert-butyl 4-(aminooxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 67065370) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is tert-butyl 4-(aminooxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4-(aminooxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 67065370 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | tert-butyl 4-(aminooxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2OC(C)(C)OC2C1CON |
| InChI | InChI=1S/C13H24N2O5/c1-12(2,3)20-11(16)15-6-9-10(8(15)7-17-14)19-13(4,5)18-9/h8-10H,6-7,14H2,1-5H3 |
| InChIKey | CBYYRRZLJVIKMO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|