C13H15N3O2 — CID 67065424
5-[(3R)-3-hydroxy-2,3,4,4a,5,6,7,7a-octahydropyrano[2,3-c]pyrrol-5-yl]pyridine-3-carbonitrile (PubChem CID 67065424) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-[(3R)-3-hydroxy-2,3,4,4a,5,6,7,7a-octahydropyrano[2,3-c]pyrrol-5-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[(3R)-3-hydroxy-2,3,4,4a,5,6,7,7a-octahydropyrano[2,3-c]pyrrol-5-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67065424 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-[(3R)-3-hydroxy-2,3,4,4a,5,6,7,7a-octahydropyrano[2,3-c]pyrrol-5-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(C2NCC3OC[C@H](O)CC32)c1 |
| InChI | InChI=1S/C13H15N3O2/c14-3-8-1-9(5-15-4-8)13-11-2-10(17)7-18-12(11)6-16-13/h1,4-5,10-13,16-17H,2,6-7H2/t10-,11?,12?,13?/m1/s1 |
| InChIKey | OISIAMNBNNVMPK-PEWWYSNMSA-N |
| XLogP | 0.36 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |