C22H21ClN6O3 — CID 67065622
3-[[5-(2-chloro-5-methoxyanilino)-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 67065622) has the molecular formula C22H21ClN6O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 3-[[5-(2-chloro-5-methoxyanilino)-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(2-chloro-5-methoxyanilino)-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67065622 |
| Molecular Formula | C22H21ClN6O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3-[[5-(2-chloro-5-methoxyanilino)-7-(cyclopropylmethylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(Cl)c(Nc2cc(NCC3CC3)n3ncc(C=C4CC(=O)NC4=O)c3n2)c1 |
| InChI | InChI=1S/C22H21ClN6O3/c1-32-15-4-5-16(23)17(8-15)26-18-9-19(24-10-12-2-3-12)29-21(27-18)14(11-25-29)6-13-7-20(30)28-22(13)31/h4-6,8-9,11-12,24H,2-3,7,10H2,1H3,(H,26,27)(H,28,30,31) |
| InChIKey | IDNSCZOYZSSZSM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|