C21H18N8O2 — CID 67065680
2-[[4-(cyclopropylamino)-8-[(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2-phenylacetonitrile (PubChem CID 67065680) has the molecular formula C21H18N8O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[[4-(cyclopropylamino)-8-[(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2-phenylacetonitrile.
| Compound Name | 2-[[4-(cyclopropylamino)-8-[(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 67065680 |
| Molecular Formula | C21H18N8O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[[4-(cyclopropylamino)-8-[(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2-phenylacetonitrile |
| SMILES | N#CC(Nc1nc(NC2CC2)n2ncc(C=C3CC(=O)NC3=O)c2n1)c1ccccc1 |
| InChI | InChI=1S/C21H18N8O2/c22-10-16(12-4-2-1-3-5-12)25-20-27-18-14(8-13-9-17(30)26-19(13)31)11-23-29(18)21(28-20)24-15-6-7-15/h1-5,8,11,15-16H,6-7,9H2,(H,26,30,31)(H2,24,25,27,28) |
| InChIKey | BBRSJIMBGVMMHJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|