C22H22F3NO4 — CID 67065844
benzyl-[(7S,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decan-7-yl]carbamic acid (PubChem CID 67065844) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is benzyl-[(7S,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decan-7-yl]carbamic acid.
| Compound Name | benzyl-[(7S,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decan-7-yl]carbamic acid |
|---|---|
| PubChem CID | 67065844 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | benzyl-[(7S,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decan-7-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@H]1CC2(CC[C@@H]1c1cc(F)c(F)cc1F)OCCO2 |
| InChI | InChI=1S/C22H22F3NO4/c23-17-11-19(25)18(24)10-16(17)15-6-7-22(29-8-9-30-22)12-20(15)26(21(27)28)13-14-4-2-1-3-5-14/h1-5,10-11,15,20H,6-9,12-13H2,(H,27,28)/t15-,20+/m1/s1 |
| InChIKey | GWRAUJKZDUOBAX-QRWLVFNGSA-N |
| XLogP | 4.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|