About 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile
4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile (PubChem CID 67066018) has the molecular formula C8H2F4N2
and a molecular weight of 202.11 g/mol. Its IUPAC name is 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile |
| PubChem CID | 67066018 |
| Molecular Formula | C8H2F4N2 |
| Molecular Weight | 202.11 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=CC(F)C(C(F)(F)F)=C1C#N |
| InChI | InChI=1S/C8H2F4N2/c9-6-1-4(2-13)5(3-14)7(6)8(10,11)12/h1,6H |
| InChIKey | GZEQLGCEZCNDPJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.11 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile?
The IUPAC name of 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile (CID 67066018) is 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile.
What is the SMILES notation for 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile?
The canonical SMILES for 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile is N#CC1=CC(F)C(C(F)(F)F)=C1C#N.
What is the InChIKey of 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile?
The InChIKey is GZEQLGCEZCNDPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F4N2/c9-6-1-4(2-13)5(3-14)7(6)8(10,11)12/h1,6H.
What are the key properties of 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile?
4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile has a molecular weight of 202.11 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-(trifluoromethyl)cyclopenta-2,5-diene-1,2-dicarbonitrile is sourced from PubChem (CID 67066018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).