About methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate
methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 67066037) has the molecular formula C15H16ClNO2
and a molecular weight of 277.75 g/mol. Its IUPAC name is methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 67066037 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1(Cl)C=CC(c2cccc(N)c2)=C(C)C1 |
| InChI | InChI=1S/C15H16ClNO2/c1-10-9-15(16,14(18)19-2)7-6-13(10)11-4-3-5-12(17)8-11/h3-8H,9,17H2,1-2H3 |
| InChIKey | CTLKUKODCRALGU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate (CID 67066037) is methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate is COC(=O)C1(Cl)C=CC(c2cccc(N)c2)=C(C)C1.
What is the InChIKey of methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is CTLKUKODCRALGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO2/c1-10-9-15(16,14(18)19-2)7-6-13(10)11-4-3-5-12(17)8-11/h3-8H,9,17H2,1-2H3.
What are the key properties of methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate?
methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 277.75 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-aminophenyl)-1-chloro-5-methylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 67066037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).