C6H12N6 — CID 67066944
2-cyclopropyl-2H-1,3,5-triazine-1,4,6-triamine (PubChem CID 67066944) has the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-cyclopropyl-2H-1,3,5-triazine-1,4,6-triamine.
| Compound Name | 2-cyclopropyl-2H-1,3,5-triazine-1,4,6-triamine |
|---|---|
| PubChem CID | 67066944 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-cyclopropyl-2H-1,3,5-triazine-1,4,6-triamine |
| SMILES | NC1=NC(C2CC2)N(N)C(N)=N1 |
| InChI | InChI=1S/C6H12N6/c7-5-10-4(3-1-2-3)12(9)6(8)11-5/h3-4H,1-2,9H2,(H4,7,8,10,11) |
| InChIKey | BDCJLBOSMJBNFM-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|