About 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole
4-cyclohexa-1,3-dien-1-yl-1,3-dioxole (PubChem CID 67067044) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole.
Molecular Properties
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole |
| PubChem CID | 67067044 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole |
| SMILES | C1=CCCC(C2=COCO2)=C1 |
| InChI | InChI=1S/C9H10O2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-2,4,6H,3,5,7H2 |
| InChIKey | ZTDIOVULHUIXHY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole?
The IUPAC name of 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole (CID 67067044) is 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole.
What is the SMILES notation for 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole?
The canonical SMILES for 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole is C1=CCCC(C2=COCO2)=C1.
What is the InChIKey of 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole?
The InChIKey is ZTDIOVULHUIXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-2,4,6H,3,5,7H2.
What are the key properties of 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole?
4-cyclohexa-1,3-dien-1-yl-1,3-dioxole has a molecular weight of 150.18 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,3-dien-1-yl-1,3-dioxole is sourced from PubChem (CID 67067044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).