C37H43N3O5Si — CID 67067791
tert-butyl N-[1-[4-[6-oxo-8-phenyl-1-(2-trimethylsilylethoxymethyl)pyrano[2,3-e]benzimidazol-7-yl]phenyl]cyclobutyl]carbamate (PubChem CID 67067791) has the molecular formula C37H43N3O5Si and a molecular weight of 637.85 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[6-oxo-8-phenyl-1-(2-trimethylsilylethoxymethyl)pyrano[2,3-e]benzimidazol-7-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[6-oxo-8-phenyl-1-(2-trimethylsilylethoxymethyl)pyrano[2,3-e]benzimidazol-7-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 67067791 |
| Molecular Formula | C37H43N3O5Si |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | tert-butyl N-[1-[4-[6-oxo-8-phenyl-1-(2-trimethylsilylethoxymethyl)pyrano[2,3-e]benzimidazol-7-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5ncn(COCC[Si](C)(C)C)c54)c3=O)cc2)CCC1 |
| InChI | InChI=1S/C37H43N3O5Si/c1-36(2,3)45-35(42)39-37(19-10-20-37)27-15-13-25(14-16-27)30-32(41)28-17-18-29-31(34(28)44-33(30)26-11-8-7-9-12-26)40(23-38-29)24-43-21-22-46(4,5)6/h7-9,11-18,23H,10,19-22,24H2,1-6H3,(H,39,42) |
| InChIKey | MCCKDKBPGCMSAN-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|