C30H24N2O2 — CID 67068048
3-amino-6-cyclobutyl-2,5,8-triphenylpyrano[2,3-c]pyridin-4-one (PubChem CID 67068048) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-amino-6-cyclobutyl-2,5,8-triphenylpyrano[2,3-c]pyridin-4-one.
| Compound Name | 3-amino-6-cyclobutyl-2,5,8-triphenylpyrano[2,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 67068048 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-amino-6-cyclobutyl-2,5,8-triphenylpyrano[2,3-c]pyridin-4-one |
| SMILES | Nc1c(-c2ccccc2)oc2c(-c3ccccc3)nc(C3CCC3)c(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C30H24N2O2/c31-25-28(33)24-23(19-11-4-1-5-12-19)26(20-17-10-18-20)32-27(21-13-6-2-7-14-21)30(24)34-29(25)22-15-8-3-9-16-22/h1-9,11-16,20H,10,17-18,31H2 |
| InChIKey | GMXKXEVWBDOEHM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |