C19H24FNOSi — CID 67068260
5-(tert-Butyl-dimethyl-silanyloxymethyl)-2-(4-fluoro-benzyl)-pyridine (PubChem CID 67068260) has the molecular formula C19H24FNOSi and a molecular weight of 329.49 g/mol.
| Compound Name | 5-(tert-Butyl-dimethyl-silanyloxymethyl)-2-(4-fluoro-benzyl)-pyridine |
|---|---|
| PubChem CID | 67068260 |
| Molecular Formula | C19H24FNOSi |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1ccc(Cc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C19H24FNOSi/c1-18(2,3)23-22-19(4,5)15-8-11-17(21-13-15)12-14-6-9-16(20)10-7-14/h6-11,13H,12H2,1-5H3 |
| InChIKey | WNBSALZDAMFCMS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|