About triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride
triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride (PubChem CID 67068279) has the molecular formula C14H31ClN4
and a molecular weight of 290.88 g/mol. Its IUPAC name is triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride.
Molecular Properties
| Compound Name | triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride |
| PubChem CID | 67068279 |
| Molecular Formula | C14H31ClN4 |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride |
| SMILES | CC/N=C(/NN1CCCCC1)[N+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C14H31N4.ClH/c1-5-15-14(18(6-2,7-3)8-4)16-17-12-10-9-11-13-17;/h5-13H2,1-4H3,(H,15,16);1H/q+1;/p-1 |
| InChIKey | VHKWWNLJBVXYAX-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride?
The IUPAC name of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride (CID 67068279) is triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride.
What is the SMILES notation for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride?
The canonical SMILES for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride is CC/N=C(/NN1CCCCC1)[N+](CC)(CC)CC.[Cl-].
What is the InChIKey of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride?
The InChIKey is VHKWWNLJBVXYAX-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H31N4.ClH/c1-5-15-14(18(6-2,7-3)8-4)16-17-12-10-9-11-13-17;/h5-13H2,1-4H3,(H,15,16);1H/q+1;/p-1.
What are the key properties of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride?
triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride has a molecular weight of 290.88 g/mol, XLogP of -0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium chloride is sourced from PubChem (CID 67068279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).