About triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium
triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium (PubChem CID 67068280) has the molecular formula C14H31N4+
and a molecular weight of 255.43 g/mol. Its IUPAC name is triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium.
Molecular Properties
| Compound Name | triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium |
| PubChem CID | 67068280 |
| Molecular Formula | C14H31N4+ |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.25 |
| IUPAC Name | triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium |
| SMILES | CC/N=C(/NN1CCCCC1)[N+](CC)(CC)CC |
| InChI | InChI=1S/C14H31N4/c1-5-15-14(18(6-2,7-3)8-4)16-17-12-10-9-11-13-17/h5-13H2,1-4H3,(H,15,16)/q+1 |
| InChIKey | XULNRFSAQHIZTN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium?
The IUPAC name of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium (CID 67068280) is triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium.
What is the SMILES notation for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium?
The canonical SMILES for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium is CC/N=C(/NN1CCCCC1)[N+](CC)(CC)CC.
What is the InChIKey of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium?
The InChIKey is XULNRFSAQHIZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N4/c1-5-15-14(18(6-2,7-3)8-4)16-17-12-10-9-11-13-17/h5-13H2,1-4H3,(H,15,16)/q+1.
What are the key properties of triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium?
triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium has a molecular weight of 255.43 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(N'-ethyl-N-piperidin-1-ylcarbamimidoyl)azanium is sourced from PubChem (CID 67068280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).