About 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester
3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester (PubChem CID 67068482) has the molecular formula C17H23N3O4
and a molecular weight of 333.40 g/mol. Its IUPAC name is ethyl 3-[[3-(2-ethoxyethoxy)-2-pyridinyl]methylamino]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester |
| PubChem CID | 67068482 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 3-[[3-(2-ethoxyethoxy)-2-pyridinyl]methylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOCCOC1=C(N=CC=C1)CNC2=C(NC=C2)C(=O)OCC |
| InChI | InChI=1S/C17H23N3O4/c1-3-22-10-11-24-15-6-5-8-18-14(15)12-20-13-7-9-19-16(13)17(21)23-4-2/h5-9,19-20H,3-4,10-12H2,1-2H3 |
| InChIKey | RJBWVGWODQBJTB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | 370 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester?
The IUPAC name of 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester (CID 67068482) is ethyl 3-[[3-(2-ethoxyethoxy)-2-pyridinyl]methylamino]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester?
The canonical SMILES for 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester is CCOCCOC1=C(N=CC=C1)CNC2=C(NC=C2)C(=O)OCC.
What is the InChIKey of 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester?
The InChIKey is RJBWVGWODQBJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O4/c1-3-22-10-11-24-15-6-5-8-18-14(15)12-20-13-7-9-19-16(13)17(21)23-4-2/h5-9,19-20H,3-4,10-12H2,1-2H3.
What are the key properties of 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester?
3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester has a molecular weight of 333.40 g/mol, XLogP of 2.40, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-({[3-(2-Ethoxyethoxy)pyridin-2-yl]methyl}amino)-1H-pyrrole-2-carboxylic acid ethyl ester is sourced from PubChem (CID 67068482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).