C19H20F3N5O5 — CID 67070087
4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-2-nitroaniline;2,2,2-trifluoroacetic acid (PubChem CID 67070087) has the molecular formula C19H20F3N5O5 and a molecular weight of 455.39 g/mol. Its IUPAC name is 4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-2-nitroaniline;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-2-nitroaniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67070087 |
| Molecular Formula | C19H20F3N5O5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-2-nitroaniline;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccc(-c2ccc(O[C@H]3CN4CCC3CC4)nn2)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N5O3.C2HF3O2/c18-13-2-1-12(9-15(13)22(23)24)14-3-4-17(20-19-14)25-16-10-21-7-5-11(16)6-8-21;3-2(4,5)1(6)7/h1-4,9,11,16H,5-8,10,18H2;(H,6,7)/t16-;/m0./s1 |
| InChIKey | BNLSZBLYJVLZJG-NTISSMGPSA-N |
| XLogP | 2.74 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|