C25H26N2O5S — CID 67070177
2-[(E)-2-[3-tert-butyl-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]-5-(methanesulfonamido)benzoic acid (PubChem CID 67070177) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[(E)-2-[3-tert-butyl-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]-5-(methanesulfonamido)benzoic acid.
| Compound Name | 2-[(E)-2-[3-tert-butyl-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]-5-(methanesulfonamido)benzoic acid |
|---|---|
| PubChem CID | 67070177 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[(E)-2-[3-tert-butyl-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]-5-(methanesulfonamido)benzoic acid |
| SMILES | CC(C)(C)c1cc(/C=C/c2ccc(NS(C)(=O)=O)cc2C(=O)O)cc(-c2ccc[nH]c2=O)c1 |
| InChI | InChI=1S/C25H26N2O5S/c1-25(2,3)19-13-16(12-18(14-19)21-6-5-11-26-23(21)28)7-8-17-9-10-20(27-33(4,31)32)15-22(17)24(29)30/h5-15,27H,1-4H3,(H,26,28)(H,29,30)/b8-7+ |
| InChIKey | CUUKIWBWPLZIJY-BQYQJAHWSA-N |
| XLogP | 4.58 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|