C13H14ClN3O2 — CID 67070690
ethyl 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanimidate (PubChem CID 67070690) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is ethyl 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanimidate.
| Compound Name | ethyl 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanimidate |
|---|---|
| PubChem CID | 67070690 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | ethyl 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanimidate |
| SMILES | [H]/N=C(/CCc1nc(-c2cccc(Cl)c2)no1)OCC |
| InChI | InChI=1S/C13H14ClN3O2/c1-2-18-11(15)6-7-12-16-13(17-19-12)9-4-3-5-10(14)8-9/h3-5,8,15H,2,6-7H2,1H3/b15-11- |
| InChIKey | AXVRSFBOFZFVOH-PTNGSMBKSA-N |
| XLogP | 3.34 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|